C30H48O2 — CID 162829943
(Z,3S,7R)-7-ethyl-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid (PubChem CID 162829943) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (Z,3S,7R)-7-ethyl-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid.
| Compound Name | (Z,3S,7R)-7-ethyl-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
|---|---|
| PubChem CID | 162829943 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (Z,3S,7R)-7-ethyl-3-[(1-phenylcyclopentyl)methyl]hexadec-9-enoic acid |
| SMILES | CCCCCC/C=C\C[C@H](CC)CCC[C@H](CC(=O)O)CC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C30H48O2/c1-3-5-6-7-8-9-11-17-26(4-2)18-16-19-27(24-29(31)32)25-30(22-14-15-23-30)28-20-12-10-13-21-28/h9-13,20-21,26-27H,3-8,14-19,22-25H2,1-2H3,(H,31,32)/b11-9-/t26-,27+/m0/s1 |
| InChIKey | TYAMTDZTJVXNPN-XQTGMEDSSA-N |
| XLogP | 9.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|