C34H55NO2 — CID 162909141
(Z,3S,4R)-4-(2-aminoethyl)-3-[[(3R)-3-phenylspiro[4.4]nonan-3-yl]methyl]hexadec-9-enoic acid (PubChem CID 162909141) has the molecular formula C34H55NO2 and a molecular weight of 509.82 g/mol. Its IUPAC name is (Z,3S,4R)-4-(2-aminoethyl)-3-[[(3R)-3-phenylspiro[4.4]nonan-3-yl]methyl]hexadec-9-enoic acid.
| Compound Name | (Z,3S,4R)-4-(2-aminoethyl)-3-[[(3R)-3-phenylspiro[4.4]nonan-3-yl]methyl]hexadec-9-enoic acid |
|---|---|
| PubChem CID | 162909141 |
| Molecular Formula | C34H55NO2 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.42 |
| IUPAC Name | (Z,3S,4R)-4-(2-aminoethyl)-3-[[(3R)-3-phenylspiro[4.4]nonan-3-yl]methyl]hexadec-9-enoic acid |
| SMILES | CCCCCC/C=C\CCCC[C@H](CCN)[C@H](CC(=O)O)C[C@]1(c2ccccc2)CCC2(CCCC2)C1 |
| InChI | InChI=1S/C34H55NO2/c1-2-3-4-5-6-7-8-9-10-12-17-29(20-25-35)30(26-32(36)37)27-34(31-18-13-11-14-19-31)24-23-33(28-34)21-15-16-22-33/h7-8,11,13-14,18-19,29-30H,2-6,9-10,12,15-17,20-28,35H2,1H3,(H,36,37)/b8-7-/t29-,30-,34-/m1/s1 |
| InChIKey | LMQDYYYOUNIWLG-BKOBNACNSA-N |
| XLogP | 9.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|