C38H53NO2 — CID 163070355
2-[(1S,2S,5R,6S)-6-(2-aminoethyl)-2-benzyl-5-[(Z,2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]cyclohex-3-en-1-yl]acetic acid (PubChem CID 163070355) has the molecular formula C38H53NO2 and a molecular weight of 555.85 g/mol. Its IUPAC name is 2-[(1S,2S,5R,6S)-6-(2-aminoethyl)-2-benzyl-5-[(Z,2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]cyclohex-3-en-1-yl]acetic acid.
| Compound Name | 2-[(1S,2S,5R,6S)-6-(2-aminoethyl)-2-benzyl-5-[(Z,2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]cyclohex-3-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 163070355 |
| Molecular Formula | C38H53NO2 |
| Molecular Weight | 555.85 g/mol |
| Exact Mass | 555.41 |
| IUPAC Name | 2-[(1S,2S,5R,6S)-6-(2-aminoethyl)-2-benzyl-5-[(Z,2R)-7-cyclohexyl-2-(2-phenylethyl)hept-4-enyl]cyclohex-3-en-1-yl]acetic acid |
| SMILES | NCC[C@@H]1[C@@H](CC(=O)O)[C@@H](Cc2ccccc2)C=C[C@H]1C[C@@H](C/C=C\CCC1CCCCC1)CCc1ccccc1 |
| InChI | InChI=1S/C38H53NO2/c39-26-25-36-34(23-24-35(37(36)29-38(40)41)27-32-18-10-4-11-19-32)28-33(22-21-31-16-8-2-9-17-31)20-12-3-7-15-30-13-5-1-6-14-30/h2-4,8-12,16-19,23-24,30,33-37H,1,5-7,13-15,20-22,25-29,39H2,(H,40,41)/b12-3-/t33-,34-,35+,36-,37-/m0/s1 |
| InChIKey | HCIBSRZYSCWXEK-WMEXEDJNSA-N |
| XLogP | 9.03 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.85 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|