C40H55NO2S2 — CID 163063071
2-[(1R,13R,14R,16R,17S,18S)-17-(2-aminoethyl)-13-benzyl-14-[(Z)-5-cyclohexylpent-2-enyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]acetic acid (PubChem CID 163063071) has the molecular formula C40H55NO2S2 and a molecular weight of 646.02 g/mol. Its IUPAC name is 2-[(1R,13R,14R,16R,17S,18S)-17-(2-aminoethyl)-13-benzyl-14-[(Z)-5-cyclohexylpent-2-enyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]acetic acid.
| Compound Name | 2-[(1R,13R,14R,16R,17S,18S)-17-(2-aminoethyl)-13-benzyl-14-[(Z)-5-cyclohexylpent-2-enyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]acetic acid |
|---|---|
| PubChem CID | 163063071 |
| Molecular Formula | C40H55NO2S2 |
| Molecular Weight | 646.02 g/mol |
| Exact Mass | 645.37 |
| IUPAC Name | 2-[(1R,13R,14R,16R,17S,18S)-17-(2-aminoethyl)-13-benzyl-14-[(Z)-5-cyclohexylpent-2-enyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]acetic acid |
| SMILES | NCC[C@@H]1[C@@H](CC(=O)O)[C@H]2C=C[C@H]1CC(C/C=C\CCC1CCCCC1)[C@@H](Cc1ccccc1)CSSCc1ccccc1C2 |
| InChI | InChI=1S/C40H55NO2S2/c41-23-22-38-34-20-21-35(39(38)27-40(42)43)25-32-18-10-11-19-36(32)28-44-45-29-37(24-31-15-7-2-8-16-31)33(26-34)17-9-3-6-14-30-12-4-1-5-13-30/h2-3,7-11,15-16,18-21,30,33-35,37-39H,1,4-6,12-14,17,22-29,41H2,(H,42,43)/b9-3-/t33?,34-,35-,37-,38-,39-/m0/s1 |
| InChIKey | XMIDDVAVRMYXNM-UICWAEEWSA-N |
| XLogP | 10.15 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.02 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|