C26H40O2 — CID 163017288
(Z,3R)-12-cyclohexyl-3-(2-phenylethyl)dodec-9-enoic acid (PubChem CID 163017288) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is (Z,3R)-12-cyclohexyl-3-(2-phenylethyl)dodec-9-enoic acid.
| Compound Name | (Z,3R)-12-cyclohexyl-3-(2-phenylethyl)dodec-9-enoic acid |
|---|---|
| PubChem CID | 163017288 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (Z,3R)-12-cyclohexyl-3-(2-phenylethyl)dodec-9-enoic acid |
| SMILES | O=C(O)C[C@H](CCCCC/C=C\CCC1CCCCC1)CCc1ccccc1 |
| InChI | InChI=1S/C26H40O2/c27-26(28)22-25(21-20-24-17-12-7-13-18-24)19-9-5-3-1-2-4-8-14-23-15-10-6-11-16-23/h2,4,7,12-13,17-18,23,25H,1,3,5-6,8-11,14-16,19-22H2,(H,27,28)/b4-2-/t25-/m1/s1 |
| InChIKey | CAMBLKWSVRQBMS-AFNUAEIFSA-N |
| XLogP | 7.58 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|