C43H61NO6S2 — CID 163160078
2-[17-(2-aminoethyl)-14-(5-cyclohexyl-4,5-dihydroxypent-2-enyl)-13-[[3-(hydroxymethyl)phenyl]methyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]-3-hydroxybutanoic acid (PubChem CID 163160078) has the molecular formula C43H61NO6S2 and a molecular weight of 752.10 g/mol. Its IUPAC name is 2-[17-(2-aminoethyl)-14-(5-cyclohexyl-4,5-dihydroxypent-2-enyl)-13-[[3-(hydroxymethyl)phenyl]methyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]-3-hydroxybutanoic acid.
| Compound Name | 2-[17-(2-aminoethyl)-14-(5-cyclohexyl-4,5-dihydroxypent-2-enyl)-13-[[3-(hydroxymethyl)phenyl]methyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 163160078 |
| Molecular Formula | C43H61NO6S2 |
| Molecular Weight | 752.10 g/mol |
| Exact Mass | 751.39 |
| IUPAC Name | 2-[17-(2-aminoethyl)-14-(5-cyclohexyl-4,5-dihydroxypent-2-enyl)-13-[[3-(hydroxymethyl)phenyl]methyl]-10,11-dithiatricyclo[14.2.2.03,8]icosa-3,5,7,19-tetraen-18-yl]-3-hydroxybutanoic acid |
| SMILES | CC(O)C(C(=O)O)C1C2C=CC(CC(CC=CC(O)C(O)C3CCCCC3)C(Cc3cccc(CO)c3)CSSCc3ccccc3C2)C1CCN |
| InChI | InChI=1S/C43H61NO6S2/c1-28(46)40(43(49)50)41-35-18-17-34(38(41)19-20-44)23-33(15-8-16-39(47)42(48)31-11-3-2-4-12-31)37(22-29-9-7-10-30(21-29)25-45)27-52-51-26-36-14-6-5-13-32(36)24-35/h5-10,13-14,16-18,21,28,31,33-35,37-42,45-48H,2-4,11-12,15,19-20,22-27,44H2,1H3,(H,49,50) |
| InChIKey | QQOHJBGWGOLTLS-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.10 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|