C15H21NO2 — CID 11064738
(E,7R)-N-benzyl-7-hydroxyoct-5-en-1-imine oxide (PubChem CID 11064738) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (E,7R)-N-benzyl-7-hydroxyoct-5-en-1-imine oxide.
| Compound Name | (E,7R)-N-benzyl-7-hydroxyoct-5-en-1-imine oxide |
|---|---|
| PubChem CID | 11064738 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (E,7R)-N-benzyl-7-hydroxyoct-5-en-1-imine oxide |
| SMILES | C[C@@H](O)/C=C/CCC/C=[N+](\[O-])Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-14(17)9-5-2-3-8-12-16(18)13-15-10-6-4-7-11-15/h4-7,9-12,14,17H,2-3,8,13H2,1H3/b9-5+,16-12-/t14-/m1/s1 |
| InChIKey | RBUZPDQKSWQSCA-MPKZEKHJSA-N |
| XLogP | 2.88 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|