C27H36O4 — CID 102582418
(E)-7-[3-[4,4-bis(phenylmethoxy)butyl]oxiran-2-yl]hept-3-en-2-ol (PubChem CID 102582418) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is (E)-7-[3-[4,4-bis(phenylmethoxy)butyl]oxiran-2-yl]hept-3-en-2-ol.
| Compound Name | (E)-7-[3-[4,4-bis(phenylmethoxy)butyl]oxiran-2-yl]hept-3-en-2-ol |
|---|---|
| PubChem CID | 102582418 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (E)-7-[3-[4,4-bis(phenylmethoxy)butyl]oxiran-2-yl]hept-3-en-2-ol |
| SMILES | CC(O)/C=C/CCCC1OC1CCCC(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C27H36O4/c1-22(28)12-5-2-10-17-25-26(31-25)18-11-19-27(29-20-23-13-6-3-7-14-23)30-21-24-15-8-4-9-16-24/h3-9,12-16,22,25-28H,2,10-11,17-21H2,1H3/b12-5+ |
| InChIKey | JHBDVXDTPJCCDN-LFYBBSHMSA-N |
| XLogP | 5.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|