C42H66O7 — CID 162350648
[1-(1-phenylmethoxy-8,8-dipropoxyoct-2-enoxy)-8,8-dipropoxyoct-2-enoxy]methylbenzene (PubChem CID 162350648) has the molecular formula C42H66O7 and a molecular weight of 682.98 g/mol. Its IUPAC name is [1-(1-phenylmethoxy-8,8-dipropoxyoct-2-enoxy)-8,8-dipropoxyoct-2-enoxy]methylbenzene.
| Compound Name | [1-(1-phenylmethoxy-8,8-dipropoxyoct-2-enoxy)-8,8-dipropoxyoct-2-enoxy]methylbenzene |
|---|---|
| PubChem CID | 162350648 |
| Molecular Formula | C42H66O7 |
| Molecular Weight | 682.98 g/mol |
| Exact Mass | 682.48 |
| IUPAC Name | [1-(1-phenylmethoxy-8,8-dipropoxyoct-2-enoxy)-8,8-dipropoxyoct-2-enoxy]methylbenzene |
| SMILES | CCCOC(CCCCC=CC(OCc1ccccc1)OC(C=CCCCCC(OCCC)OCCC)OCc1ccccc1)OCCC |
| InChI | InChI=1S/C42H66O7/c1-5-31-43-39(44-32-6-2)27-19-9-11-21-29-41(47-35-37-23-15-13-16-24-37)49-42(48-36-38-25-17-14-18-26-38)30-22-12-10-20-28-40(45-33-7-3)46-34-8-4/h13-18,21-26,29-30,39-42H,5-12,19-20,27-28,31-36H2,1-4H3 |
| InChIKey | DPNQMHVRMLIUIC-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.98 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|