C34H66O7 — CID 162350636
1-methoxy-1-(1-methoxy-10,10-dipropoxydec-2-enoxy)-10,10-dipropoxydec-2-ene (PubChem CID 162350636) has the molecular formula C34H66O7 and a molecular weight of 586.90 g/mol. Its IUPAC name is 1-methoxy-1-(1-methoxy-10,10-dipropoxydec-2-enoxy)-10,10-dipropoxydec-2-ene.
| Compound Name | 1-methoxy-1-(1-methoxy-10,10-dipropoxydec-2-enoxy)-10,10-dipropoxydec-2-ene |
|---|---|
| PubChem CID | 162350636 |
| Molecular Formula | C34H66O7 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.48 |
| IUPAC Name | 1-methoxy-1-(1-methoxy-10,10-dipropoxydec-2-enoxy)-10,10-dipropoxydec-2-ene |
| SMILES | CCCOC(CCCCCCC=CC(OC)OC(C=CCCCCCCC(OCCC)OCCC)OC)OCCC |
| InChI | InChI=1S/C34H66O7/c1-7-27-37-33(38-28-8-2)25-21-17-13-11-15-19-23-31(35-5)41-32(36-6)24-20-16-12-14-18-22-26-34(39-29-9-3)40-30-10-4/h19-20,23-24,31-34H,7-18,21-22,25-30H2,1-6H3 |
| InChIKey | VWHFCCXSEFQQMR-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|