C40H78O7 — CID 162350477
1-(7,7-dihexoxy-1-methoxyhept-2-enoxy)-7,7-dihexoxy-1-methoxyhept-2-ene (PubChem CID 162350477) has the molecular formula C40H78O7 and a molecular weight of 671.06 g/mol. Its IUPAC name is 1-(7,7-dihexoxy-1-methoxyhept-2-enoxy)-7,7-dihexoxy-1-methoxyhept-2-ene.
| Compound Name | 1-(7,7-dihexoxy-1-methoxyhept-2-enoxy)-7,7-dihexoxy-1-methoxyhept-2-ene |
|---|---|
| PubChem CID | 162350477 |
| Molecular Formula | C40H78O7 |
| Molecular Weight | 671.06 g/mol |
| Exact Mass | 670.57 |
| IUPAC Name | 1-(7,7-dihexoxy-1-methoxyhept-2-enoxy)-7,7-dihexoxy-1-methoxyhept-2-ene |
| SMILES | CCCCCCOC(CCCC=CC(OC)OC(C=CCCCC(OCCCCCC)OCCCCCC)OC)OCCCCCC |
| InChI | InChI=1S/C40H78O7/c1-7-11-15-25-33-43-39(44-34-26-16-12-8-2)31-23-19-21-29-37(41-5)47-38(42-6)30-22-20-24-32-40(45-35-27-17-13-9-3)46-36-28-18-14-10-4/h21-22,29-30,37-40H,7-20,23-28,31-36H2,1-6H3 |
| InChIKey | LQRPGHQNSPZJPG-UHFFFAOYSA-N |
| XLogP | 11.44 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.06 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|