C50H98O7 — CID 162350291
1-methoxy-1-(1-methoxy-8,8-dioctoxyoct-2-enoxy)-8,8-dioctoxyoct-2-ene (PubChem CID 162350291) has the molecular formula C50H98O7 and a molecular weight of 811.33 g/mol. Its IUPAC name is 1-methoxy-1-(1-methoxy-8,8-dioctoxyoct-2-enoxy)-8,8-dioctoxyoct-2-ene.
| Compound Name | 1-methoxy-1-(1-methoxy-8,8-dioctoxyoct-2-enoxy)-8,8-dioctoxyoct-2-ene |
|---|---|
| PubChem CID | 162350291 |
| Molecular Formula | C50H98O7 |
| Molecular Weight | 811.33 g/mol |
| Exact Mass | 810.73 |
| IUPAC Name | 1-methoxy-1-(1-methoxy-8,8-dioctoxyoct-2-enoxy)-8,8-dioctoxyoct-2-ene |
| SMILES | CCCCCCCCOC(CCCCC=CC(OC)OC(C=CCCCCC(OCCCCCCCC)OCCCCCCCC)OC)OCCCCCCCC |
| InChI | InChI=1S/C50H98O7/c1-7-11-15-19-27-35-43-53-49(54-44-36-28-20-16-12-8-2)41-33-25-23-31-39-47(51-5)57-48(52-6)40-32-24-26-34-42-50(55-45-37-29-21-17-13-9-3)56-46-38-30-22-18-14-10-4/h31-32,39-40,47-50H,7-30,33-38,41-46H2,1-6H3 |
| InChIKey | SHCHTAXKVWSIFA-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.33 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|