C36H70O7 — CID 162350306
9,9-dibutoxy-1-(9,9-dibutoxy-1-methoxynon-2-enoxy)-1-methoxynon-2-ene (PubChem CID 162350306) has the molecular formula C36H70O7 and a molecular weight of 614.95 g/mol. Its IUPAC name is 9,9-dibutoxy-1-(9,9-dibutoxy-1-methoxynon-2-enoxy)-1-methoxynon-2-ene.
| Compound Name | 9,9-dibutoxy-1-(9,9-dibutoxy-1-methoxynon-2-enoxy)-1-methoxynon-2-ene |
|---|---|
| PubChem CID | 162350306 |
| Molecular Formula | C36H70O7 |
| Molecular Weight | 614.95 g/mol |
| Exact Mass | 614.51 |
| IUPAC Name | 9,9-dibutoxy-1-(9,9-dibutoxy-1-methoxynon-2-enoxy)-1-methoxynon-2-ene |
| SMILES | CCCCOC(CCCCCC=CC(OC)OC(C=CCCCCCC(OCCCC)OCCCC)OC)OCCCC |
| InChI | InChI=1S/C36H70O7/c1-7-11-29-39-35(40-30-12-8-2)27-23-19-15-17-21-25-33(37-5)43-34(38-6)26-22-18-16-20-24-28-36(41-31-13-9-3)42-32-14-10-4/h21-22,25-26,33-36H,7-20,23-24,27-32H2,1-6H3 |
| InChIKey | FBUIPHQHFMVMLX-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.95 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|