C25H28O5 — CID 70497646
4-[2-[3-(3-hydroxy-4-phenoxybut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid (PubChem CID 70497646) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is 4-[2-[3-(3-hydroxy-4-phenoxybut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[3-(3-hydroxy-4-phenoxybut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70497646 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 4-[2-[3-(3-hydroxy-4-phenoxybut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC2C3CCC(O3)C2C=CC(O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28O5/c26-19(16-29-20-4-2-1-3-5-20)11-13-22-21(23-14-15-24(22)30-23)12-8-17-6-9-18(10-7-17)25(27)28/h1-7,9-11,13,19,21-24,26H,8,12,14-16H2,(H,27,28) |
| InChIKey | NAXLJBDKKDXDPD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|