C26H28O4 — CID 70498299
4-[2-[(1R,2R,3S,4S)-3-[(E)-4-(4-methylphenyl)-3-oxobut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid (PubChem CID 70498299) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[2-[(1R,2R,3S,4S)-3-[(E)-4-(4-methylphenyl)-3-oxobut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(1R,2R,3S,4S)-3-[(E)-4-(4-methylphenyl)-3-oxobut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70498299 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 4-[2-[(1R,2R,3S,4S)-3-[(E)-4-(4-methylphenyl)-3-oxobut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
| SMILES | Cc1ccc(CC(=O)/C=C/[C@H]2[C@@H](CCc3ccc(C(=O)O)cc3)[C@H]3CC[C@@H]2O3)cc1 |
| InChI | InChI=1S/C26H28O4/c1-17-2-4-19(5-3-17)16-21(27)11-13-23-22(24-14-15-25(23)30-24)12-8-18-6-9-20(10-7-18)26(28)29/h2-7,9-11,13,22-25H,8,12,14-16H2,1H3,(H,28,29)/b13-11+/t22-,23+,24-,25+/m1/s1 |
| InChIKey | VWAAQTCUUFISAS-HVTIZUFRSA-N |
| XLogP | 4.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|