C21H31NO3 — CID 70514578
4-[2-[(1S,2S,3R,4R)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid (PubChem CID 70514578) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 4-[2-[(1S,2S,3R,4R)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(1S,2S,3R,4R)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70514578 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 4-[2-[(1S,2S,3R,4R)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
| SMILES | CCCCCCN[C@@H]1[C@H](CCc2ccc(C(=O)O)cc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H31NO3/c1-2-3-4-5-14-22-20-17(18-12-13-19(20)25-18)11-8-15-6-9-16(10-7-15)21(23)24/h6-7,9-10,17-20,22H,2-5,8,11-14H2,1H3,(H,23,24)/t17-,18+,19-,20-/m1/s1 |
| InChIKey | FPBJUGXIQCRXTO-IYWMVGAKSA-N |
| XLogP | 4.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|