C23H24O4S — CID 70498062
4-[2-[(2S,3S,4S)-3-[(E)-3-oxo-4-thiophen-3-ylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid (PubChem CID 70498062) has the molecular formula C23H24O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 4-[2-[(2S,3S,4S)-3-[(E)-3-oxo-4-thiophen-3-ylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2S,3S,4S)-3-[(E)-3-oxo-4-thiophen-3-ylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 70498062 |
| Molecular Formula | C23H24O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-[2-[(2S,3S,4S)-3-[(E)-3-oxo-4-thiophen-3-ylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethyl]benzoic acid |
| SMILES | O=C(/C=C/[C@@H]1[C@@H]2CCC(O2)[C@H]1CCc1ccc(C(=O)O)cc1)Cc1ccsc1 |
| InChI | InChI=1S/C23H24O4S/c24-18(13-16-11-12-28-14-16)6-8-20-19(21-9-10-22(20)27-21)7-3-15-1-4-17(5-2-15)23(25)26/h1-2,4-6,8,11-12,14,19-22H,3,7,9-10,13H2,(H,25,26)/b8-6+/t19-,20-,21?,22-/m0/s1 |
| InChIKey | LRJLMKACVJJGOK-CPIHBSQCSA-N |
| XLogP | 4.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|