C21H26O4S — CID 56632362
7-[(1R,2S,3S,4S)-3-(3-oxo-4-thiophen-3-ylbut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 56632362) has the molecular formula C21H26O4S and a molecular weight of 374.50 g/mol. Its IUPAC name is 7-[(1R,2S,3S,4S)-3-(3-oxo-4-thiophen-3-ylbut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2S,3S,4S)-3-(3-oxo-4-thiophen-3-ylbut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56632362 |
| Molecular Formula | C21H26O4S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 7-[(1R,2S,3S,4S)-3-(3-oxo-4-thiophen-3-ylbut-1-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@H]1[C@H](C=CC(=O)Cc2ccsc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H26O4S/c22-16(13-15-11-12-26-14-15)7-8-18-17(19-9-10-20(18)25-19)5-3-1-2-4-6-21(23)24/h1,3,7-8,11-12,14,17-20H,2,4-6,9-10,13H2,(H,23,24)/t17-,18-,19+,20-/m0/s1 |
| InChIKey | ZVWPOBDFVOXHNN-HAGHYFMRSA-N |
| XLogP | 4.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|