C25H32O4 — CID 70469726
(Z)-7-[(1R,3S,4S)-3-[(E)-4-methyl-3-oxo-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70469726) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is (Z)-7-[(1R,3S,4S)-3-[(E)-4-methyl-3-oxo-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,3S,4S)-3-[(E)-4-methyl-3-oxo-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70469726 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (Z)-7-[(1R,3S,4S)-3-[(E)-4-methyl-3-oxo-4-phenylpent-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CC(C)(C(=O)/C=C/[C@H]1C(C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2)c1ccccc1 |
| InChI | InChI=1S/C25H32O4/c1-25(2,18-10-6-5-7-11-18)23(26)17-14-20-19(21-15-16-22(20)29-21)12-8-3-4-9-13-24(27)28/h3,5-8,10-11,14,17,19-22H,4,9,12-13,15-16H2,1-2H3,(H,27,28)/b8-3-,17-14+/t19?,20-,21+,22-/m0/s1 |
| InChIKey | PDGUNRMLESZUNZ-OTXDHOJBSA-N |
| XLogP | 5.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|