C24H29ClO2 — CID 143611519
4-[2-[(1S)-3-chloro-2-[2-(2,3-dimethylphenyl)ethyl]cyclopentyl]ethyl]benzoic acid (PubChem CID 143611519) has the molecular formula C24H29ClO2 and a molecular weight of 384.95 g/mol. Its IUPAC name is 4-[2-[(1S)-3-chloro-2-[2-(2,3-dimethylphenyl)ethyl]cyclopentyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(1S)-3-chloro-2-[2-(2,3-dimethylphenyl)ethyl]cyclopentyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 143611519 |
| Molecular Formula | C24H29ClO2 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 4-[2-[(1S)-3-chloro-2-[2-(2,3-dimethylphenyl)ethyl]cyclopentyl]ethyl]benzoic acid |
| SMILES | Cc1cccc(CCC2C(Cl)CC[C@@H]2CCc2ccc(C(=O)O)cc2)c1C |
| InChI | InChI=1S/C24H29ClO2/c1-16-4-3-5-19(17(16)2)12-14-22-20(13-15-23(22)25)9-6-18-7-10-21(11-8-18)24(26)27/h3-5,7-8,10-11,20,22-23H,6,9,12-15H2,1-2H3,(H,26,27)/t20-,22?,23?/m0/s1 |
| InChIKey | VZEFFNLYGIBURS-RBKXMNCYSA-N |
| XLogP | 6.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|