C20H33ClO4S — CID 11441096
5-[[(1S,2R,3R,5S)-5-chloro-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxycyclopentyl]methylsulfanyl]pentanoic acid (PubChem CID 11441096) has the molecular formula C20H33ClO4S and a molecular weight of 405.00 g/mol. Its IUPAC name is 5-[[(1S,2R,3R,5S)-5-chloro-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxycyclopentyl]methylsulfanyl]pentanoic acid.
| Compound Name | 5-[[(1S,2R,3R,5S)-5-chloro-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxycyclopentyl]methylsulfanyl]pentanoic acid |
|---|---|
| PubChem CID | 11441096 |
| Molecular Formula | C20H33ClO4S |
| Molecular Weight | 405.00 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 5-[[(1S,2R,3R,5S)-5-chloro-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxycyclopentyl]methylsulfanyl]pentanoic acid |
| SMILES | O=C(O)CCCCSC[C@@H]1[C@@H](/C=C/[C@@H](O)C2CCCCC2)[C@H](O)C[C@@H]1Cl |
| InChI | InChI=1S/C20H33ClO4S/c21-17-12-19(23)15(9-10-18(22)14-6-2-1-3-7-14)16(17)13-26-11-5-4-8-20(24)25/h9-10,14-19,22-23H,1-8,11-13H2,(H,24,25)/b10-9+/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | SCCFSEHQJDMKGM-UZFGRETFSA-N |
| XLogP | 4.08 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.00 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|