C22H32O7 — CID 139636328
5-[(1R,2R,3R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentanecarbonyl]oxyhept-6-enoic acid (PubChem CID 139636328) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is 5-[(1R,2R,3R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentanecarbonyl]oxyhept-6-enoic acid.
| Compound Name | 5-[(1R,2R,3R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentanecarbonyl]oxyhept-6-enoic acid |
|---|---|
| PubChem CID | 139636328 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 5-[(1R,2R,3R)-2-[(E,3S)-3-cyclohexyl-3-hydroxyprop-1-enyl]-3-hydroxy-5-oxocyclopentanecarbonyl]oxyhept-6-enoic acid |
| SMILES | C=CC(CCCC(=O)O)OC(=O)[C@H]1C(=O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C22H32O7/c1-2-15(9-6-10-20(26)27)29-22(28)21-16(18(24)13-19(21)25)11-12-17(23)14-7-4-3-5-8-14/h2,11-12,14-18,21,23-24H,1,3-10,13H2,(H,26,27)/b12-11+/t15?,16-,17+,18+,21+/m0/s1 |
| InChIKey | OMPYCYGHPVFWCQ-MCIFWEBZSA-N |
| XLogP | 2.40 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|