C20H26O4 — CID 88641090
(E,7Z)-7-[2-[(E)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid (PubChem CID 88641090) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (E,7Z)-7-[2-[(E)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid.
| Compound Name | (E,7Z)-7-[2-[(E)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid |
|---|---|
| PubChem CID | 88641090 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (E,7Z)-7-[2-[(E)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-oxocyclopent-3-en-1-ylidene]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/C=C1\C(=O)C=CC1/C=C/C(O)C1CCCC1 |
| InChI | InChI=1S/C20H26O4/c21-18(16-7-5-6-8-16)13-11-15-12-14-19(22)17(15)9-3-1-2-4-10-20(23)24/h1,3,9,11-16,18,21H,2,4-8,10H2,(H,23,24)/b3-1+,13-11+,17-9- |
| InChIKey | PODQPPXKFADVLN-HHEXHOATSA-N |
| XLogP | 3.59 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|