C18H32N2O4S — CID 54547413
2-[4-[(5-cyclohexyl-5-hydroxypentyl)carbamoylamino]but-2-enylsulfanyl]acetic acid (PubChem CID 54547413) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is 2-[4-[(5-cyclohexyl-5-hydroxypentyl)carbamoylamino]but-2-enylsulfanyl]acetic acid.
| Compound Name | 2-[4-[(5-cyclohexyl-5-hydroxypentyl)carbamoylamino]but-2-enylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 54547413 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-[4-[(5-cyclohexyl-5-hydroxypentyl)carbamoylamino]but-2-enylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCC=CCNC(=O)NCCCCC(O)C1CCCCC1 |
| InChI | InChI=1S/C18H32N2O4S/c21-16(15-8-2-1-3-9-15)10-4-5-11-19-18(24)20-12-6-7-13-25-14-17(22)23/h6-7,15-16,21H,1-5,8-14H2,(H,22,23)(H2,19,20,24) |
| InChIKey | ZHMLMHRBQFOVKO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|