C20H32O4Si — CID 10361441
methyl 2-[(2R,3S,4R,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)-3-trimethylsilyloxolan-2-yl]acetate (PubChem CID 10361441) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is methyl 2-[(2R,3S,4R,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)-3-trimethylsilyloxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3S,4R,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)-3-trimethylsilyloxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10361441 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | methyl 2-[(2R,3S,4R,5S)-3,4-dimethyl-5-(phenylmethoxymethyl)-3-trimethylsilyloxolan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1O[C@H](COCc2ccccc2)[C@@H](C)[C@]1(C)[Si](C)(C)C |
| InChI | InChI=1S/C20H32O4Si/c1-15-17(14-23-13-16-10-8-7-9-11-16)24-18(12-19(21)22-3)20(15,2)25(4,5)6/h7-11,15,17-18H,12-14H2,1-6H3/t15-,17-,18-,20+/m1/s1 |
| InChIKey | HQXKDGXCKQHHCF-UIXUWTQFSA-N |
| XLogP | 4.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|