C35H61BrO2Si — CID 11028534
(1R,4aR,4bR,7S,8aR,10aR)-1-[2-(2-bromo-4,4-dimethylcyclohexen-1-yl)ethyl]-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 11028534) has the molecular formula C35H61BrO2Si and a molecular weight of 621.86 g/mol. Its IUPAC name is (1R,4aR,4bR,7S,8aR,10aR)-1-[2-(2-bromo-4,4-dimethylcyclohexen-1-yl)ethyl]-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | (1R,4aR,4bR,7S,8aR,10aR)-1-[2-(2-bromo-4,4-dimethylcyclohexen-1-yl)ethyl]-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 11028534 |
| Molecular Formula | C35H61BrO2Si |
| Molecular Weight | 621.86 g/mol |
| Exact Mass | 620.36 |
| IUPAC Name | (1R,4aR,4bR,7S,8aR,10aR)-1-[2-(2-bromo-4,4-dimethylcyclohexen-1-yl)ethyl]-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8,10a-pentamethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | CC1(C)CCC(CC[C@@]2(C)C(=O)CC[C@@H]3[C@@]4(C)CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@@H]4CC[C@]32C)=C(Br)C1 |
| InChI | InChI=1S/C35H61BrO2Si/c1-30(2,3)39(11,12)38-29-18-20-33(8)26(32(29,6)7)17-22-34(9)27(33)13-14-28(37)35(34,10)21-16-24-15-19-31(4,5)23-25(24)36/h26-27,29H,13-23H2,1-12H3/t26-,27+,29-,33-,34+,35-/m0/s1 |
| InChIKey | WNUQBFNHDQJTCA-ILOTUDJZSA-N |
| XLogP | 11.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.86 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|