About ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate
ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate (PubChem CID 10352750) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate.
Analyze ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate?
The IUPAC name of ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate (CID 10352750) is ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate.
What is the SMILES notation for ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate?
The canonical SMILES for ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate is CCOC(=O)[C@H](C)[C@@H]1OC(=O)C[C@H]1C.
What is the InChIKey of ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate?
The InChIKey is XKKWOCHHQTZUQS-ZXFLCMHBSA-N. The full InChI is InChI=1S/C10H16O4/c1-4-13-10(12)7(3)9-6(2)5-8(11)14-9/h6-7,9H,4-5H2,1-3H3/t6-,7-,9-/m1/s1.
What are the key properties of ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate?
ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate has a molecular weight of 200.23 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[(2R,3R)-3-methyl-5-oxooxolan-2-yl]propanoate is sourced from PubChem (CID 10352750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).