C11H20O4 — CID 101136322
ethyl 2-[(2S,4R,6S)-4-hydroxy-6-methyloxan-2-yl]propanoate (PubChem CID 101136322) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is ethyl 2-[(2S,4R,6S)-4-hydroxy-6-methyloxan-2-yl]propanoate.
| Compound Name | ethyl 2-[(2S,4R,6S)-4-hydroxy-6-methyloxan-2-yl]propanoate |
|---|---|
| PubChem CID | 101136322 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | ethyl 2-[(2S,4R,6S)-4-hydroxy-6-methyloxan-2-yl]propanoate |
| SMILES | CCOC(=O)C(C)C1C[C@H](O)C[C@H](C)O1 |
| InChI | InChI=1S/C11H20O4/c1-4-14-11(13)8(3)10-6-9(12)5-7(2)15-10/h7-10,12H,4-6H2,1-3H3/t7-,8?,9+,10?/m0/s1 |
| InChIKey | IESQQOQHYFMMBR-QGVKSAJWSA-N |
| XLogP | 1.11 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |