C20H39BO3 — CID 144994429
2-[(E)-3-heptan-2-yloxyhept-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 144994429) has the molecular formula C20H39BO3 and a molecular weight of 338.34 g/mol. Its IUPAC name is 2-[(E)-3-heptan-2-yloxyhept-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E)-3-heptan-2-yloxyhept-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 144994429 |
| Molecular Formula | C20H39BO3 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | 2-[(E)-3-heptan-2-yloxyhept-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCC(C)OC(/C=C/B1OC(C)(C)C(C)(C)O1)CCCC |
| InChI | InChI=1S/C20H39BO3/c1-8-10-12-13-17(3)22-18(14-11-9-2)15-16-21-23-19(4,5)20(6,7)24-21/h15-18H,8-14H2,1-7H3/b16-15+ |
| InChIKey | GGPCSONEFDUVCQ-FOCLMDBBSA-N |
| XLogP | 5.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|