C26H36O5 — CID 71519429
methyl (Z)-6-[(4S,5R)-5-[(1E,3E,7E,9S,11Z)-9-hydroxytetradeca-1,3,7,11-tetraen-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-enoate (PubChem CID 71519429) has the molecular formula C26H36O5 and a molecular weight of 428.57 g/mol. Its IUPAC name is methyl (Z)-6-[(4S,5R)-5-[(1E,3E,7E,9S,11Z)-9-hydroxytetradeca-1,3,7,11-tetraen-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(4S,5R)-5-[(1E,3E,7E,9S,11Z)-9-hydroxytetradeca-1,3,7,11-tetraen-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-enoate |
|---|---|
| PubChem CID | 71519429 |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | methyl (Z)-6-[(4S,5R)-5-[(1E,3E,7E,9S,11Z)-9-hydroxytetradeca-1,3,7,11-tetraen-5-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hex-4-enoate |
| SMILES | CC/C=C\C[C@H](O)/C=C/C#C/C=C/C=C/[C@H]1OC(C)(C)O[C@H]1C/C=C\CCC(=O)OC |
| InChI | InChI=1S/C26H36O5/c1-5-6-12-17-22(27)18-13-9-7-8-10-14-19-23-24(31-26(2,3)30-23)20-15-11-16-21-25(28)29-4/h6,8,10-15,18-19,22-24,27H,5,16-17,20-21H2,1-4H3/b10-8+,12-6-,15-11-,18-13+,19-14+/t22-,23+,24-/m0/s1 |
| InChIKey | LOAYHOXGNNCRGH-CXGIBLTQSA-N |
| XLogP | 4.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|