C14H25NO3 — CID 70473913
ethyl 3-methyl-2-(4,4,6-trimethyl-1,3-oxazinan-2-yl)but-3-enoate (PubChem CID 70473913) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is ethyl 3-methyl-2-(4,4,6-trimethyl-1,3-oxazinan-2-yl)but-3-enoate.
| Compound Name | ethyl 3-methyl-2-(4,4,6-trimethyl-1,3-oxazinan-2-yl)but-3-enoate |
|---|---|
| PubChem CID | 70473913 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | ethyl 3-methyl-2-(4,4,6-trimethyl-1,3-oxazinan-2-yl)but-3-enoate |
| SMILES | C=C(C)C(C(=O)OCC)C1NC(C)(C)CC(C)O1 |
| InChI | InChI=1S/C14H25NO3/c1-7-17-13(16)11(9(2)3)12-15-14(5,6)8-10(4)18-12/h10-12,15H,2,7-8H2,1,3-6H3 |
| InChIKey | SKOJYHQNEDEPSJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|