C43H78N2O12 — CID 11262915
N,N'-bis[[(4R,5S)-5-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dioctylpropanediamide (PubChem CID 11262915) has the molecular formula C43H78N2O12 and a molecular weight of 815.10 g/mol. Its IUPAC name is N,N'-bis[[(4R,5S)-5-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dioctylpropanediamide.
| Compound Name | N,N'-bis[[(4R,5S)-5-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dioctylpropanediamide |
|---|---|
| PubChem CID | 11262915 |
| Molecular Formula | C43H78N2O12 |
| Molecular Weight | 815.10 g/mol |
| Exact Mass | 814.56 |
| IUPAC Name | N,N'-bis[[(4R,5S)-5-[(4R,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2,2-dioctylpropanediamide |
| SMILES | CCCCCCCCC(CCCCCCCC)(C(=O)NC[C@H]1OC(C)(C)O[C@@H]1[C@@H]1OC(C)(C)O[C@H]1CO)C(=O)NC[C@H]1OC(C)(C)O[C@@H]1[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C43H78N2O12/c1-11-13-15-17-19-21-23-43(24-22-20-18-16-14-12-2,37(48)44-25-29-33(54-39(3,4)50-29)35-31(27-46)52-41(7,8)56-35)38(49)45-26-30-34(55-40(5,6)51-30)36-32(28-47)53-42(9,10)57-36/h29-36,46-47H,11-28H2,1-10H3,(H,44,48)(H,45,49)/t29-,30-,31+,32+,33+,34+,35-,36-/m1/s1 |
| InChIKey | HROFKJSJBUHXJD-QQWKDDOISA-N |
| XLogP | 5.77 |
| TPSA | 172.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.10 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|