C19H34O3 — CID 10781286
(4R,5R)-4-(hydroxymethyl)-3-methylidene-5-tridecyloxolan-2-one (PubChem CID 10781286) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is (4R,5R)-4-(hydroxymethyl)-3-methylidene-5-tridecyloxolan-2-one.
| Compound Name | (4R,5R)-4-(hydroxymethyl)-3-methylidene-5-tridecyloxolan-2-one |
|---|---|
| PubChem CID | 10781286 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | (4R,5R)-4-(hydroxymethyl)-3-methylidene-5-tridecyloxolan-2-one |
| SMILES | C=C1C(=O)O[C@H](CCCCCCCCCCCCC)[C@H]1CO |
| InChI | InChI=1S/C19H34O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-18-17(15-20)16(2)19(21)22-18/h17-18,20H,2-15H2,1H3/t17-,18+/m0/s1 |
| InChIKey | LKPDAZSYZNCXIR-ZWKOTPCHSA-N |
| XLogP | 4.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|