C19H32O5 — CID 10871538
butyl (2S)-2-hydroxy-2-[(2R,3R)-4-methylidene-2-octyl-5-oxooxolan-3-yl]acetate (PubChem CID 10871538) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is butyl (2S)-2-hydroxy-2-[(2R,3R)-4-methylidene-2-octyl-5-oxooxolan-3-yl]acetate.
| Compound Name | butyl (2S)-2-hydroxy-2-[(2R,3R)-4-methylidene-2-octyl-5-oxooxolan-3-yl]acetate |
|---|---|
| PubChem CID | 10871538 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | butyl (2S)-2-hydroxy-2-[(2R,3R)-4-methylidene-2-octyl-5-oxooxolan-3-yl]acetate |
| SMILES | C=C1C(=O)O[C@H](CCCCCCCC)[C@H]1[C@H](O)C(=O)OCCCC |
| InChI | InChI=1S/C19H32O5/c1-4-6-8-9-10-11-12-15-16(14(3)18(21)24-15)17(20)19(22)23-13-7-5-2/h15-17,20H,3-13H2,1-2H3/t15-,16+,17+/m1/s1 |
| InChIKey | ULPYOAVIFGFDSV-IKGGRYGDSA-N |
| XLogP | 3.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|