C20H32O2 — CID 15866742
(4S,5S)-4-hex-5-enyl-3-methylidene-5-non-8-enyloxolan-2-one (PubChem CID 15866742) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (4S,5S)-4-hex-5-enyl-3-methylidene-5-non-8-enyloxolan-2-one.
| Compound Name | (4S,5S)-4-hex-5-enyl-3-methylidene-5-non-8-enyloxolan-2-one |
|---|---|
| PubChem CID | 15866742 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (4S,5S)-4-hex-5-enyl-3-methylidene-5-non-8-enyloxolan-2-one |
| SMILES | C=CCCCCCCC[C@@H]1OC(=O)C(=C)[C@@H]1CCCCC=C |
| InChI | InChI=1S/C20H32O2/c1-4-6-8-10-11-12-14-16-19-18(15-13-9-7-5-2)17(3)20(21)22-19/h4-5,18-19H,1-3,6-16H2/t18-,19-/m0/s1 |
| InChIKey | RARKSDFKFNXGDF-OALUTQOASA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|