C17H26O2 — CID 86656473
(3S,4S)-3-non-8-enyl-4-pent-4-ynyloxetan-2-one (PubChem CID 86656473) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (3S,4S)-3-non-8-enyl-4-pent-4-ynyloxetan-2-one.
| Compound Name | (3S,4S)-3-non-8-enyl-4-pent-4-ynyloxetan-2-one |
|---|---|
| PubChem CID | 86656473 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (3S,4S)-3-non-8-enyl-4-pent-4-ynyloxetan-2-one |
| SMILES | C#CCCC[C@@H]1OC(=O)[C@H]1CCCCCCCC=C |
| InChI | InChI=1S/C17H26O2/c1-3-5-7-8-9-10-12-13-15-16(19-17(15)18)14-11-6-4-2/h2-3,15-16H,1,5-14H2/t15-,16-/m0/s1 |
| InChIKey | KQQIMGZXPCOHSQ-HOTGVXAUSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|