C19H30O2 — CID 15866738
(4S,5S)-3-methylidene-5-non-8-enyl-4-pent-4-enyloxolan-2-one (PubChem CID 15866738) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (4S,5S)-3-methylidene-5-non-8-enyl-4-pent-4-enyloxolan-2-one.
| Compound Name | (4S,5S)-3-methylidene-5-non-8-enyl-4-pent-4-enyloxolan-2-one |
|---|---|
| PubChem CID | 15866738 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (4S,5S)-3-methylidene-5-non-8-enyl-4-pent-4-enyloxolan-2-one |
| SMILES | C=CCCCCCCC[C@@H]1OC(=O)C(=C)[C@@H]1CCCC=C |
| InChI | InChI=1S/C19H30O2/c1-4-6-8-9-10-11-13-15-18-17(14-12-7-5-2)16(3)19(20)21-18/h4-5,17-18H,1-3,6-15H2/t17-,18-/m0/s1 |
| InChIKey | RTITVLQXMIYKRQ-ROUUACIJSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|