C18H26N2O3 — CID 102422649
(6S)-6-benzyl-3-hexyl-3-(hydroxymethyl)piperazine-2,5-dione (PubChem CID 102422649) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is (6S)-6-benzyl-3-hexyl-3-(hydroxymethyl)piperazine-2,5-dione.
| Compound Name | (6S)-6-benzyl-3-hexyl-3-(hydroxymethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 102422649 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | (6S)-6-benzyl-3-hexyl-3-(hydroxymethyl)piperazine-2,5-dione |
| SMILES | CCCCCCC1(CO)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C18H26N2O3/c1-2-3-4-8-11-18(13-21)17(23)19-15(16(22)20-18)12-14-9-6-5-7-10-14/h5-7,9-10,15,21H,2-4,8,11-13H2,1H3,(H,19,23)(H,20,22)/t15-,18?/m0/s1 |
| InChIKey | QHMIXRBBFCVGQZ-BUSXIPJBSA-N |
| XLogP | 1.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|