C13H16N2O3S — CID 162987141
3-benzyl-6-(hydroxymethyl)-3-methylsulfanylpiperazine-2,5-dione (PubChem CID 162987141) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-benzyl-6-(hydroxymethyl)-3-methylsulfanylpiperazine-2,5-dione.
| Compound Name | 3-benzyl-6-(hydroxymethyl)-3-methylsulfanylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 162987141 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-benzyl-6-(hydroxymethyl)-3-methylsulfanylpiperazine-2,5-dione |
| SMILES | CSC1(Cc2ccccc2)NC(=O)C(CO)NC1=O |
| InChI | InChI=1S/C13H16N2O3S/c1-19-13(7-9-5-3-2-4-6-9)12(18)14-10(8-16)11(17)15-13/h2-6,10,16H,7-8H2,1H3,(H,14,18)(H,15,17) |
| InChIKey | OGNOJEQUKKDYNU-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |