C15H21N — CID 167446481
(1S,5R)-8-benzylbicyclo[3.2.1]octan-3-amine (PubChem CID 167446481) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (1S,5R)-8-benzylbicyclo[3.2.1]octan-3-amine.
| Compound Name | (1S,5R)-8-benzylbicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 167446481 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (1S,5R)-8-benzylbicyclo[3.2.1]octan-3-amine |
| SMILES | NC1C[C@H]2CC[C@@H](C1)C2Cc1ccccc1 |
| InChI | InChI=1S/C15H21N/c16-14-9-12-6-7-13(10-14)15(12)8-11-4-2-1-3-5-11/h1-5,12-15H,6-10,16H2/t12-,13+,14?,15? |
| InChIKey | YMJZKVXJGLUHBT-DGKWVBSXSA-N |
| XLogP | 2.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |