C12H12O3 — CID 125485515
(2R,6S)-6-benzyl-2-hydroxy-2H-pyran-5-one (PubChem CID 125485515) has the molecular formula C12H12O3 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2R,6S)-6-benzyl-2-hydroxy-2H-pyran-5-one.
| Compound Name | (2R,6S)-6-benzyl-2-hydroxy-2H-pyran-5-one |
|---|---|
| PubChem CID | 125485515 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (2R,6S)-6-benzyl-2-hydroxy-2H-pyran-5-one |
| SMILES | O=C1C=C[C@H](O)O[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C12H12O3/c13-10-6-7-12(14)15-11(10)8-9-4-2-1-3-5-9/h1-7,11-12,14H,8H2/t11-,12+/m0/s1 |
| InChIKey | UQDGWJAWRSAOPL-NWDGAFQWSA-N |
| XLogP | 1.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |