C12H11NO2 — CID 70180981
3-benzyl-1H-pyridine-2,4-dione (PubChem CID 70180981) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-benzyl-1H-pyridine-2,4-dione.
| Compound Name | 3-benzyl-1H-pyridine-2,4-dione |
|---|---|
| PubChem CID | 70180981 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-benzyl-1H-pyridine-2,4-dione |
| SMILES | O=C1C=CNC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C12H11NO2/c14-11-6-7-13-12(15)10(11)8-9-4-2-1-3-5-9/h1-7,10H,8H2,(H,13,15) |
| InChIKey | YKWFEAIKLWXQSU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|