About 3-benzyl-1H-pyridine-2,4-dione
3-benzyl-1H-pyridine-2,4-dione (PubChem CID 70180981) has the molecular formula C12H11NO2
and a molecular weight of 201.23 g/mol. Its IUPAC name is 3-benzyl-1H-pyridine-2,4-dione.
Molecular Properties
| Compound Name | 3-benzyl-1H-pyridine-2,4-dione |
| PubChem CID | 70180981 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 3-benzyl-1H-pyridine-2,4-dione |
| SMILES | O=C1C=CNC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C12H11NO2/c14-11-6-7-13-12(15)10(11)8-9-4-2-1-3-5-9/h1-7,10H,8H2,(H,13,15) |
| InChIKey | YKWFEAIKLWXQSU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-1H-pyridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1H-pyridine-2,4-dione?
The IUPAC name of 3-benzyl-1H-pyridine-2,4-dione (CID 70180981) is 3-benzyl-1H-pyridine-2,4-dione.
What is the SMILES notation for 3-benzyl-1H-pyridine-2,4-dione?
The canonical SMILES for 3-benzyl-1H-pyridine-2,4-dione is O=C1C=CNC(=O)C1Cc1ccccc1.
What is the InChIKey of 3-benzyl-1H-pyridine-2,4-dione?
The InChIKey is YKWFEAIKLWXQSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c14-11-6-7-13-12(15)10(11)8-9-4-2-1-3-5-9/h1-7,10H,8H2,(H,13,15).
What are the key properties of 3-benzyl-1H-pyridine-2,4-dione?
3-benzyl-1H-pyridine-2,4-dione has a molecular weight of 201.23 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1H-pyridine-2,4-dione is sourced from PubChem (CID 70180981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).