C9H15NO — CID 121480613
2-[(2R)-6-methyl-1,2-dihydropyridin-2-yl]propan-1-ol (PubChem CID 121480613) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-[(2R)-6-methyl-1,2-dihydropyridin-2-yl]propan-1-ol.
| Compound Name | 2-[(2R)-6-methyl-1,2-dihydropyridin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 121480613 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-[(2R)-6-methyl-1,2-dihydropyridin-2-yl]propan-1-ol |
| SMILES | CC1=CC=C[C@H](C(C)CO)N1 |
| InChI | InChI=1S/C9H15NO/c1-7(6-11)9-5-3-4-8(2)10-9/h3-5,7,9-11H,6H2,1-2H3/t7?,9-/m1/s1 |
| InChIKey | XBTUXMBWTPGDPV-NHSZFOGYSA-N |
| XLogP | 1.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |