About 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol
1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol (PubChem CID 18968481) has the molecular formula C17H32O2
and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol |
| PubChem CID | 18968481 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol |
| SMILES | CC(O)C1CCCC1.CC1=CCC(C(C)CO)CC1 |
| InChI | InChI=1S/C10H18O.C7H14O/c1-8-3-5-10(6-4-8)9(2)7-11;1-6(8)7-4-2-3-5-7/h3,9-11H,4-7H2,1-2H3;6-8H,2-5H2,1H3 |
| InChIKey | XDEGOCQOQSRXFS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol?
The IUPAC name of 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol (CID 18968481) is 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol.
What is the SMILES notation for 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol?
The canonical SMILES for 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol is CC(O)C1CCCC1.CC1=CCC(C(C)CO)CC1.
What is the InChIKey of 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol?
The InChIKey is XDEGOCQOQSRXFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O.C7H14O/c1-8-3-5-10(6-4-8)9(2)7-11;1-6(8)7-4-2-3-5-7/h3,9-11H,4-7H2,1-2H3;6-8H,2-5H2,1H3.
What are the key properties of 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol?
1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol has a molecular weight of 268.44 g/mol, XLogP of 3.92, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylethanol;2-(4-methylcyclohex-3-en-1-yl)propan-1-ol is sourced from PubChem (CID 18968481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).