About 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium)
4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) (PubChem CID 156810022) has the molecular formula C18H26O2Y2-2
and a molecular weight of 452.22 g/mol. Its IUPAC name is 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium).
Molecular Properties
| Compound Name | 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) |
| PubChem CID | 156810022 |
| Molecular Formula | C18H26O2Y2-2 |
| Molecular Weight | 452.22 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) |
| SMILES | CCC(C)C1CC=C(C)CC1.Cc1[c-]c(O)cc(O)[c-]1.[Y].[Y] |
| InChI | InChI=1S/C11H20.C7H6O2.2Y/c1-4-10(3)11-7-5-9(2)6-8-11;1-5-2-6(8)4-7(9)3-5;;/h5,10-11H,4,6-8H2,1-3H3;4,8-9H,1H3;;/q;-2;; |
| InChIKey | SFVWUHKNHGIOAW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.22 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium)?
The IUPAC name of 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) (CID 156810022) is 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium).
What is the SMILES notation for 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium)?
The canonical SMILES for 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) is CCC(C)C1CC=C(C)CC1.Cc1[c-]c(O)cc(O)[c-]1.[Y].[Y].
What is the InChIKey of 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium)?
The InChIKey is SFVWUHKNHGIOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20.C7H6O2.2Y/c1-4-10(3)11-7-5-9(2)6-8-11;1-5-2-6(8)4-7(9)3-5;;/h5,10-11H,4,6-8H2,1-3H3;4,8-9H,1H3;;/q;-2;;.
What are the key properties of 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium)?
4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) has a molecular weight of 452.22 g/mol, XLogP of 4.78, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-1-methylcyclohexene;5-methylbenzene-4,6-diide-1,3-diol;bis(yttrium) is sourced from PubChem (CID 156810022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).