C22H34O2Y2-2 — CID 156810058
4-butan-2-yl-1-methylcyclohexene;5-pentylbenzene-4,6-diide-1,3-diol;bis(yttrium) (PubChem CID 156810058) has the molecular formula C22H34O2Y2-2 and a molecular weight of 508.32 g/mol. Its IUPAC name is 4-butan-2-yl-1-methylcyclohexene;5-pentylbenzene-4,6-diide-1,3-diol;bis(yttrium).
| Compound Name | 4-butan-2-yl-1-methylcyclohexene;5-pentylbenzene-4,6-diide-1,3-diol;bis(yttrium) |
|---|---|
| PubChem CID | 156810058 |
| Molecular Formula | C22H34O2Y2-2 |
| Molecular Weight | 508.32 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 4-butan-2-yl-1-methylcyclohexene;5-pentylbenzene-4,6-diide-1,3-diol;bis(yttrium) |
| SMILES | CCC(C)C1CC=C(C)CC1.CCCCCc1[c-]c(O)cc(O)[c-]1.[Y].[Y] |
| InChI | InChI=1S/C11H14O2.C11H20.2Y/c1-2-3-4-5-9-6-10(12)8-11(13)7-9;1-4-10(3)11-7-5-9(2)6-8-11;;/h8,12-13H,2-5H2,1H3;5,10-11H,4,6-8H2,1-3H3;;/q-2;;; |
| InChIKey | AHSRQWUIUIHQAZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.32 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|