C22H38O2 — CID 156810055
5-butylbenzene-1,3-diol;ethane;1-methyl-4-propan-2-ylcyclohexene (PubChem CID 156810055) has the molecular formula C22H38O2 and a molecular weight of 334.54 g/mol. Its IUPAC name is 5-butylbenzene-1,3-diol;ethane;1-methyl-4-propan-2-ylcyclohexene.
| Compound Name | 5-butylbenzene-1,3-diol;ethane;1-methyl-4-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 156810055 |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.54 g/mol |
| Exact Mass | 334.29 |
| IUPAC Name | 5-butylbenzene-1,3-diol;ethane;1-methyl-4-propan-2-ylcyclohexene |
| SMILES | CC.CC1=CCC(C(C)C)CC1.CCCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C10H14O2.C10H18.C2H6/c1-2-3-4-8-5-9(11)7-10(12)6-8;1-8(2)10-6-4-9(3)5-7-10;1-2/h5-7,11-12H,2-4H2,1H3;4,8,10H,5-7H2,1-3H3;1-2H3 |
| InChIKey | GFSCAERXPFOKRG-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|