C25H42O2 — CID 161151221
5-(2-methyloctan-2-yl)benzene-1,3-diol;(4R)-1-methyl-4-propan-2-ylcyclohexene (PubChem CID 161151221) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is 5-(2-methyloctan-2-yl)benzene-1,3-diol;(4R)-1-methyl-4-propan-2-ylcyclohexene.
| Compound Name | 5-(2-methyloctan-2-yl)benzene-1,3-diol;(4R)-1-methyl-4-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 161151221 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | 5-(2-methyloctan-2-yl)benzene-1,3-diol;(4R)-1-methyl-4-propan-2-ylcyclohexene |
| SMILES | CC1=CC[C@H](C(C)C)CC1.CCCCCCC(C)(C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H24O2.C10H18/c1-4-5-6-7-8-15(2,3)12-9-13(16)11-14(17)10-12;1-8(2)10-6-4-9(3)5-7-10/h9-11,16-17H,4-8H2,1-3H3;4,8,10H,5-7H2,1-3H3/t;10-/m.0/s1 |
| InChIKey | UORYTMMSPPNTIP-CICJTZRQSA-N |
| XLogP | 7.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|