C27H45NO3 — CID 42625284
N-(cyclopropylmethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide (PubChem CID 42625284) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide.
| Compound Name | N-(cyclopropylmethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide |
|---|---|
| PubChem CID | 42625284 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | N-(cyclopropylmethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide |
| SMILES | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCC(=O)NCC2CC2)c1 |
| InChI | InChI=1S/C27H45NO3/c1-4-5-6-11-16-27(2,3)23-18-24(29)20-25(19-23)31-17-12-9-7-8-10-13-26(30)28-21-22-14-15-22/h18-20,22,29H,4-17,21H2,1-3H3,(H,28,30) |
| InChIKey | NKPLGBDGCIRYGY-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|