C25H43NO4 — CID 42626166
N-(2-hydroxyethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide (PubChem CID 42626166) has the molecular formula C25H43NO4 and a molecular weight of 421.62 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide.
| Compound Name | N-(2-hydroxyethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide |
|---|---|
| PubChem CID | 42626166 |
| Molecular Formula | C25H43NO4 |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.32 |
| IUPAC Name | N-(2-hydroxyethyl)-8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octanamide |
| SMILES | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCC(=O)NCCO)c1 |
| InChI | InChI=1S/C25H43NO4/c1-4-5-6-11-14-25(2,3)21-18-22(28)20-23(19-21)30-17-12-9-7-8-10-13-24(29)26-15-16-27/h18-20,27-28H,4-17H2,1-3H3,(H,26,29) |
| InChIKey | LXIZCYKFRPCCJS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|